EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H40O5 |
| Net Charge | 0 |
| Average Mass | 480.645 |
| Monoisotopic Mass | 480.28757 |
| SMILES | [H][C@]12C=C(C=C)C[C@]34CC[C@@]5([H])C(C)(C)CCC[C@]56C[C@@]31[C@@]1(OC[C@@](C)(O)[C@@]2([H])[C@](C(C)C)(C4=O)C1=O)O6 |
| InChI | InChI=1S/C30H40O5/c1-7-18-13-19-21-25(6,33)16-34-30-23(32)29(21,17(2)3)22(31)26(14-18)12-9-20-24(4,5)10-8-11-27(20,35-30)15-28(19,26)30/h7,13,17,19-21,33H,1,8-12,14-16H2,2-6H3/t19-,20+,21+,25-,26+,27+,28+,29-,30+/m1/s1 |
| InChIKey | FOQBZJXMAZZAIA-NQWLPLNFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia hydrangea (ncbitaxon:392666) | aerial part (BTO:0001658) | PubMed (21967089) | n-Hexane extract of air-dried, powdered aerial parts. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Salvadione C (CHEBI:69690) has role metabolite (CHEBI:25212) |
| Salvadione C (CHEBI:69690) is a oxacycle (CHEBI:38104) |
| Citations |
|---|