EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21NO |
| Net Charge | 0 |
| Average Mass | 195.306 |
| Monoisotopic Mass | 195.16231 |
| SMILES | CCCCCCC/C=C/C=C/C(N)=O |
| InChI | InChI=1S/C12H21NO/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h8-11H,2-7H2,1H3,(H2,13,14)/b9-8+,11-10+ |
| InChIKey | ZJDVIVOFURPUPP-BNFZFUHLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper sarmentosum (ncbitaxon:405319) | |||
| inflorescence (BTO:0000628) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| stem (BTO:0001300) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| twig (BTO:0001411) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| leaf (BTO:0000713) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-Dodecadienamide (CHEBI:69687) has role metabolite (CHEBI:25212) |
| 2,4-Dodecadienamide (CHEBI:69687) is a enol ether (CHEBI:47985) |
| 2,4-Dodecadienamide (CHEBI:69687) is a enone (CHEBI:51689) |
| Citations |
|---|