EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H25NO |
| Net Charge | 0 |
| Average Mass | 223.360 |
| Monoisotopic Mass | 223.19361 |
| SMILES | CCCCC/C=C/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C14H25NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h8-11,13H,4-7,12H2,1-3H3,(H,15,16)/b9-8+,11-10+ |
| InChIKey | MAGQQZHFHJDIRE-BNFZFUHLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper boehmeriaefolium (ncbitaxon:130389) | whole plant (BTO:0001461) | PubMed (21158422) | Methanolic extract of air-dried, powdered whole plant |
| Piper sarmentosum (ncbitaxon:405319) | |||
| twig (BTO:0001411) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| stem (BTO:0001300) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| inflorescence (BTO:0000628) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| leaf (BTO:0000713) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pellitorine (CHEBI:69686) has role metabolite (CHEBI:25212) |
| pellitorine (CHEBI:69686) is a fatty amide (CHEBI:29348) |
| IUPAC Name |
|---|
| (2E,4E)-N-(2-methylpropyl)deca-2,4-dienamide |
| Synonyms | Source |
|---|---|
| (2E,4E)-N-isobutyl-2,4-decadienamide | ChEBI |
| trans-Pellitorin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:18836-52-7 | ChemIDplus |
| Citations |
|---|