EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O6 |
| Net Charge | 0 |
| Average Mass | 482.532 |
| Monoisotopic Mass | 482.17294 |
| SMILES | COc1c(Cc2ccccc2O)c(O)c2c(c1Cc1ccccc1O)O[C@H](c1ccccc1)CC2=O |
| InChI | InChI=1S/C30H26O6/c1-35-29-21(15-19-11-5-7-13-23(19)31)28(34)27-25(33)17-26(18-9-3-2-4-10-18)36-30(27)22(29)16-20-12-6-8-14-24(20)32/h2-14,26,31-32,34H,15-17H2,1H3/t26-/m0/s1 |
| InChIKey | HUNWUDHAPSHKOD-SANMLTNESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper sarmentosum (ncbitaxon:405319) | |||
| inflorescence (BTO:0000628) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| twig (BTO:0001411) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| leaf (BTO:0000713) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| stem (BTO:0001300) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-Methoxydichamanetin (CHEBI:69682) has role metabolite (CHEBI:25212) |
| 7-Methoxydichamanetin (CHEBI:69682) is a diarylheptanoid (CHEBI:78802) |
| Synonym | Source |
|---|---|
| (2S)-5-Hydroxy-6,8-bis(2-hydroxybenzyl)-7-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one | ChEBI |
| Citations |
|---|