EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30O7 |
| Net Charge | 0 |
| Average Mass | 418.486 |
| Monoisotopic Mass | 418.19915 |
| SMILES | C/C=C/c1cc(OC)c(O[C@H](C)[C@H](O)c2cc(OC)c(OC)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C23H30O7/c1-8-9-15-10-17(25-3)23(18(11-15)26-4)30-14(2)21(24)16-12-19(27-5)22(29-7)20(13-16)28-6/h8-14,21,24H,1-7H3/b9-8+/t14-,21+/m1/s1 |
| InChIKey | FLBWVIKFCMUTDS-UGZSOSCUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acorus gramineus (ncbitaxon:55184) | rhizome (BTO:0001181) | PubMed (21936523) | 80% aqueous methanolic extract of rhizomes. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7R,8R)-Polysphorin (CHEBI:69673) has role metabolite (CHEBI:25212) |
| (7R,8R)-Polysphorin (CHEBI:69673) is a phenylpropanoid (CHEBI:26004) |
| Synonyms | Source |
|---|---|
| Polysyphorin | ChEBI |
| (1R,2R)-2-{2,6-Dimethoxy-4-[(1E)-1-propen-1-yl]phenoxy}-1-(3,4,5-trimethoxyphenyl)-1-propanol | ChEBI |
| Citations |
|---|