EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O7 |
| Net Charge | 0 |
| Average Mass | 378.421 |
| Monoisotopic Mass | 378.16785 |
| SMILES | COc1cc([C@H](O)[C@H](CO)Oc2ccc(CCCO)cc2OC)ccc1O |
| InChI | InChI=1S/C20H26O7/c1-25-17-11-14(6-7-15(17)23)20(24)19(12-22)27-16-8-5-13(4-3-9-21)10-18(16)26-2/h5-8,10-11,19-24H,3-4,9,12H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | DBIKJXXBCAHHMC-PMACEKPBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acorus gramineus (ncbitaxon:55184) | rhizome (BTO:0001181) | PubMed (21936523) | 80% aqueous methanolic extract of rhizomes. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7S,8S)-4,7,9,9'-Tetrahydroxy-3,3'-dimethoxy-8-O-4'-neolignan (CHEBI:69671) has role metabolite (CHEBI:25212) |
| (7S,8S)-4,7,9,9'-Tetrahydroxy-3,3'-dimethoxy-8-O-4'-neolignan (CHEBI:69671) is a phenylpropanoid (CHEBI:26004) |
| Synonym | Source |
|---|---|
| (1S,2S)-1-(4-Hydroxy-3-methoxyphenyl)-2-[4-(3-hydroxypropyl)-2-methoxyphenoxy]-1,3-propanediol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8866394 | ChemSpider |
| Citations |
|---|