EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30O6 |
| Net Charge | 0 |
| Average Mass | 402.487 |
| Monoisotopic Mass | 402.20424 |
| SMILES | COc1ccc([C@H]2O[C@H](c3cc(OC)c(OC)c(OC)c3)[C@@H](C)[C@@H]2C)cc1OC |
| InChI | InChI=1S/C23H30O6/c1-13-14(2)22(16-11-19(26-5)23(28-7)20(12-16)27-6)29-21(13)15-8-9-17(24-3)18(10-15)25-4/h8-14,21-22H,1-7H3/t13-,14-,21-,22-/m0/s1 |
| InChIKey | FUFHSLKNBJRCDG-WJWAULOUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acorus gramineus (ncbitaxon:55184) | rhizome (BTO:0001181) | PubMed (21936523) | 80% aqueous methanolic extract of rhizomes. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Methoxygalbelgin (CHEBI:69670) has role metabolite (CHEBI:25212) |
| 5-Methoxygalbelgin (CHEBI:69670) is a lignan (CHEBI:25036) |
| Citations |
|---|