EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:69669 - Veraguensin
| Formula | C22H28O5 |
| Net Charge | 0 |
| Average Mass | 372.461 |
| Monoisotopic Mass | 372.19367 |
| SMILES | COc1ccc([C@H]2O[C@@H](c3ccc(OC)c(OC)c3)[C@@H](C)[C@@H]2C)cc1OC |
| InChI | InChI=1S/C22H28O5/c1-13-14(2)22(16-8-10-18(24-4)20(12-16)26-6)27-21(13)15-7-9-17(23-3)19(11-15)25-5/h7-14,21-22H,1-6H3/t13-,14-,21-,22+/m0/s1 |
| InChIKey | JLJAVUZBHSLLJL-GKHNXXNSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acorus gramineus (ncbitaxon:55184) | rhizome (BTO:0001181) | PubMed (21936523) | 80% aqueous methanolic extract of rhizomes. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Veraguensin (CHEBI:69669) has role metabolite (CHEBI:25212) |
| Veraguensin (CHEBI:69669) is a lignan (CHEBI:25036) |
| Synonym | Source |
|---|---|
| (2R,3S,4S,5S)-2,5-Bis(3,4-dimethoxyphenyl)-3,4-dimethyltetrahydrofuran | ChEBI |
| Citations |
|---|