EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O14 |
| Net Charge | 0 |
| Average Mass | 598.598 |
| Monoisotopic Mass | 598.22616 |
| SMILES | COc1cc([C@@H]2O[C@@H](c3cc(OC)c(O)c(OC)c3)[C@H](CO[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H]2CO)cc(OC)c1O |
| InChI | InChI=1S/C28H38O14/c1-36-16-5-12(6-17(37-2)21(16)31)26-14(9-29)15(11-40-28-25(35)24(34)23(33)20(10-30)41-28)27(42-26)13-7-18(38-3)22(32)19(8-13)39-4/h5-8,14-15,20,23-35H,9-11H2,1-4H3/t14-,15-,20-,23-,24+,25-,26+,27+,28-/m1/s1 |
| InChIKey | FHFLZYGQOCDSKY-FCEOPEINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acorus gramineus (ncbitaxon:55184) | rhizome (BTO:0001181) | PubMed (21936523) | 80% aqueous methanolic extract of rhizomes. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ligraminol B (CHEBI:69664) has role metabolite (CHEBI:25212) |
| Ligraminol B (CHEBI:69664) is a glycoside (CHEBI:24400) |
| Ligraminol B (CHEBI:69664) is a lignan (CHEBI:25036) |
| Synonym | Source |
|---|---|
| (2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R)-2,5-bis(4-hydroxy-3,5-dimethoxyphenyl)-4-(hydroxymethyl)oxolan-3-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol | ChEBI |
| Citations |
|---|