EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32O8 |
| Net Charge | 0 |
| Average Mass | 460.523 |
| Monoisotopic Mass | 460.20972 |
| SMILES | [H][C@]12OC(=O)C(=C)[C@]([H])([C@@H]1OC(=O)CC(C)(C)O)[C@H](OC(=O)/C(C)=C\C)[C@]1(C)C(=O)C=C[C@@]1([H])[C@@H]2C |
| InChI | InChI=1S/C25H32O8/c1-8-12(2)22(28)33-21-18-14(4)23(29)32-19(20(18)31-17(27)11-24(5,6)30)13(3)15-9-10-16(26)25(15,21)7/h8-10,13,15,18-21,30H,4,11H2,1-3,5-7H3/b12-8-/t13-,15-,18+,19+,20-,21-,25-/m0/s1 |
| InChIKey | BJUHMHABNCTBSM-TZDXKJQASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Athroisma proteiforme (IPNI:182889-1) | aerial part (BTO:0001658) | PubMed (21995542) | Ethyl alcohol extract of dried, ground aerial parts. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Athrolide C, (rel)- (CHEBI:69660) has role metabolite (CHEBI:25212) |
| Athrolide C, (rel)- (CHEBI:69660) is a carbonyl compound (CHEBI:36586) |
| Synonym | Source |
|---|---|
| rel-1S,7R,10(H)R-4-oxo-6S-[(Z)-2-methyl-2-butenoyloxy]-8S-(3-hydroxy-3-methyl-butanoyloxy)pseudoguaia-2(3),11-(13)-dien-9R,12-olide | ChEBI |
| Citations |
|---|