EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32O8 |
| Net Charge | 0 |
| Average Mass | 436.501 |
| Monoisotopic Mass | 436.20972 |
| SMILES | [H][C@]12[C@H](C)C[C@]3([H])OC(=O)C(=C)[C@@]3([H])[C@H](OC(C)=O)[C@]1(C)[C@H](OC(C)=O)C[C@@H]2OC(=O)C(C)C |
| InChI | InChI=1S/C23H32O8/c1-10(2)21(26)31-16-9-17(28-13(5)24)23(7)19(16)11(3)8-15-18(12(4)22(27)30-15)20(23)29-14(6)25/h10-11,15-20H,4,8-9H2,1-3,5-7H3/t11-,15+,16+,17-,18-,19-,20+,23-/m1/s1 |
| InChIKey | NDMSWUKPDPLPAZ-WDPXAWCQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Athroisma proteiforme (IPNI:182889-1) | aerial part (BTO:0001658) | PubMed (21995542) | Ethyl alcohol extract of dried, ground aerial parts. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Athrolide A (CHEBI:69658) has role metabolite (CHEBI:25212) |
| Athrolide A (CHEBI:69658) is a sesquiterpene lactone (CHEBI:37667) |
| Synonym | Source |
|---|---|
| (1S,2S,4R,5S,6S,7R,8S,10R)-2-(2-methylpropanoyloxy)-4-acetoxy-6-acetoxyguai-11(13)-en-8,12-olide | ChEBI |
| Citations |
|---|