EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O15 |
| Net Charge | 0 |
| Average Mass | 594.522 |
| Monoisotopic Mass | 594.15847 |
| SMILES | C[C@@H]1O[C@@H](OC[C@H]2O[C@@H](Oc3c(-c4ccc(O)cc4)oc4cc(O)cc(O)c4c3=O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H30O15/c1-9-17(31)20(34)22(36)26(39-9)38-8-15-18(32)21(35)23(37)27(41-15)42-25-19(33)16-13(30)6-12(29)7-14(16)40-24(25)10-2-4-11(28)5-3-10/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15+,17-,18+,20+,21-,22+,23+,26+,27-/m0/s1 |
| InChIKey | RTATXGUCZHCSNG-QHWHWDPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum campaniforme (IPNI:818569-1) | leaf (BTO:0000713) | PubMed (21962208) | Dried leaves were extracted with ethyl alcohol. |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kaempferol-3-rutinoside (CHEBI:69657) has role metabolite (CHEBI:25212) |
| kaempferol-3-rutinoside (CHEBI:69657) has role plant metabolite (CHEBI:76924) |
| kaempferol-3-rutinoside (CHEBI:69657) has role radical scavenger (CHEBI:48578) |
| kaempferol-3-rutinoside (CHEBI:69657) is a disaccharide derivative (CHEBI:63353) |
| kaempferol-3-rutinoside (CHEBI:69657) is a kaempferol O-glucoside (CHEBI:64634) |
| kaempferol-3-rutinoside (CHEBI:69657) is a rutinoside (CHEBI:26587) |
| kaempferol-3-rutinoside (CHEBI:69657) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 3-((6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl)oxy)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| kaempferol 3-O-(6''-O-α-L-rhamnopyranosyl)-β-D-glucopyranoside | ChEBI |
| Kaempferol-3-O-β-rutinoside | ChemIDplus |
| nicotiflorin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:74581 | Reaxys |
| CAS:17650-84-9 | ChemIDplus |
| Citations |
|---|