EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O15 |
| Net Charge | 0 |
| Average Mass | 594.522 |
| Monoisotopic Mass | 594.15847 |
| SMILES | C[C@@H]1O[C@@H](OC[C@H]2O[C@@H](Oc3c(-c4ccc(O)cc4)oc4cc(O)cc(O)c4c3=O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H30O15/c1-9-17(31)20(34)22(36)26(39-9)38-8-15-18(32)21(35)23(37)27(41-15)42-25-19(33)16-13(30)6-12(29)7-14(16)40-24(25)10-2-4-11(28)5-3-10/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15+,17-,18+,20+,21-,22+,23+,26+,27-/m0/s1 |
| InChIKey | RTATXGUCZHCSNG-QHWHWDPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum campaniforme (IPNI:818569-1) | leaf (BTO:0000713) | PubMed (21962208) | Dried leaves were extracted with ethyl alcohol. |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kaempferol-3-rutinoside (CHEBI:69657) has role metabolite (CHEBI:25212) |
| kaempferol-3-rutinoside (CHEBI:69657) has role plant metabolite (CHEBI:76924) |
| kaempferol-3-rutinoside (CHEBI:69657) has role radical scavenger (CHEBI:48578) |
| kaempferol-3-rutinoside (CHEBI:69657) is a disaccharide derivative (CHEBI:63353) |
| kaempferol-3-rutinoside (CHEBI:69657) is a kaempferol O-glucoside (CHEBI:64634) |
| kaempferol-3-rutinoside (CHEBI:69657) is a rutinoside (CHEBI:26587) |
| kaempferol-3-rutinoside (CHEBI:69657) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| nicotiflorin | ChemIDplus |
| kaempferol 3-O-(6''-O-α-L-rhamnopyranosyl)-β-D-glucopyranoside | ChEBI |
| 3-((6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl)oxy)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| Kaempferol-3-O-β-rutinoside | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:74581 | Reaxys |
| CAS:17650-84-9 | ChemIDplus |
| Citations |
|---|