EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O4 |
| Net Charge | 0 |
| Average Mass | 208.213 |
| Monoisotopic Mass | 208.07356 |
| SMILES | CCOC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H12O4/c1-2-15-11(14)6-4-8-3-5-9(12)10(13)7-8/h3-7,12-13H,2H2,1H3/b6-4+ |
| InChIKey | WDKYDMULARNCIS-GQCTYLIASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum campaniforme (IPNI:818569-1) | leaf (BTO:0000713) | PubMed (21962208) | Dried leaves were extracted with ethyl alcohol. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Caffeic acid ethyl ester (CHEBI:69656) has role metabolite (CHEBI:25212) |
| Caffeic acid ethyl ester (CHEBI:69656) is a hydroxycinnamic acid (CHEBI:24689) |
| Synonyms | Source |
|---|---|
| 3,4-Dihydroxycinnamic acid ethyl ester | ChEBI |
| Ethyl caffeate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 0000102374 | ChemIDplus |
| Citations |
|---|