EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H37NO2 |
| Net Charge | 0 |
| Average Mass | 407.598 |
| Monoisotopic Mass | 407.28243 |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])N3C[C@@H](C)C[C@@]4([H])O[C@@]34[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C27H37NO2/c1-15-11-23-27(30-23)16(2)24-22(28(27)14-15)13-21-19-6-5-17-12-18(29)7-9-25(17,3)20(19)8-10-26(21,24)4/h7,9,12,15-16,19-24H,5-6,8,10-11,13-14H2,1-4H3/t15-,16-,19+,20-,21-,22-,23+,24-,25-,26-,27+/m0/s1 |
| InChIKey | UGAJCJIZYPKGTJ-WUOUAPBYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum campaniforme (IPNI:818569-1) | leaf (BTO:0000713) | PubMed (21962208) | Dried leaves were extracted with ethyl alcohol. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 22alpha,23alpha-epoxy-solanida-1,4-dien-3-one, (rel)- (CHEBI:69654) has role metabolite (CHEBI:25212) |
| 22alpha,23alpha-epoxy-solanida-1,4-dien-3-one, (rel)- (CHEBI:69654) is a oxo steroid (CHEBI:35789) |
| Citations |
|---|