EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H33NO11 |
| Net Charge | 0 |
| Average Mass | 535.546 |
| Monoisotopic Mass | 535.20536 |
| SMILES | [H][C@@]1(O[C@@H]2OC=C(C(=O)OC)[C@@H](/C=C/c3ccc[n+](CCCC(=O)[O-])c3)[C@H]2C=C)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H33NO11/c1-3-16-17(9-8-15-6-4-10-27(12-15)11-5-7-20(29)30)18(24(34)35-2)14-36-25(16)38-26-23(33)22(32)21(31)19(13-28)37-26/h3-4,6,8-10,12,14,16-17,19,21-23,25-26,28,31-33H,1,5,7,11,13H2,2H3/b9-8+/t16-,17+,19-,21-,22+,23-,25+,26+/m1/s1 |
| InChIKey | PJIVLFIKRZQZOE-URGZVSNXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lonicera japonica (ncbitaxon:105884) | flower bud (BTO:0000470) | PubMed (21942812) | Air dried flower bud. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lonijaposide N (CHEBI:69652) has role metabolite (CHEBI:25212) |
| Lonijaposide N (CHEBI:69652) is a terpene glycoside (CHEBI:61777) |
| Citations |
|---|