EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31NO11 |
| Net Charge | 0 |
| Average Mass | 521.519 |
| Monoisotopic Mass | 521.18971 |
| SMILES | [H][C@@]1(O[C@@H]2OC=C(C(=O)[O-])[C@@H](/C=C/c3ccc[n+](CCCC(=O)O)c3)[C@H]2C=C)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H31NO11/c1-2-15-16(8-7-14-5-3-9-26(11-14)10-4-6-19(28)29)17(23(33)34)13-35-24(15)37-25-22(32)21(31)20(30)18(12-27)36-25/h2-3,5,7-9,11,13,15-16,18,20-22,24-25,27,30-32H,1,4,6,10,12H2,(H-,28,29,33,34)/b8-7+/t15-,16+,18-,20-,21+,22-,24+,25+/m1/s1 |
| InChIKey | UEEFSWPSRLSUQJ-NOMYRAODSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lonicera japonica (ncbitaxon:105884) | flower bud (BTO:0000470) | PubMed (21942812) | Air dried flower bud. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lonijaposide M (CHEBI:69651) has role metabolite (CHEBI:25212) |
| Lonijaposide M (CHEBI:69651) is a terpene glycoside (CHEBI:61777) |
| Citations |
|---|