EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29NO11 |
| Net Charge | 0 |
| Average Mass | 507.492 |
| Monoisotopic Mass | 507.17406 |
| SMILES | [H][C@@]1(O[C@@H]2OC=C(C(=O)[O-])[C@@H](/C=C/c3ccc[n+](CCC(=O)O)c3)[C@H]2C=C)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H29NO11/c1-2-14-15(6-5-13-4-3-8-25(10-13)9-7-18(27)28)16(22(32)33)12-34-23(14)36-24-21(31)20(30)19(29)17(11-26)35-24/h2-6,8,10,12,14-15,17,19-21,23-24,26,29-31H,1,7,9,11H2,(H-,27,28,32,33)/b6-5+/t14-,15+,17-,19-,20+,21-,23+,24+/m1/s1 |
| InChIKey | ONSYQRQUUDJRLS-IRTUFKDUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lonicera japonica (ncbitaxon:105884) | flower bud (BTO:0000470) | PubMed (21942812) | Air dried flower bud. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lonijaposide L (CHEBI:69650) has role metabolite (CHEBI:25212) |
| Lonijaposide L (CHEBI:69650) is a terpene glycoside (CHEBI:61777) |
| Citations |
|---|