EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24N2O2 |
| Net Charge | 0 |
| Average Mass | 276.380 |
| Monoisotopic Mass | 276.18378 |
| SMILES | CCc1c(C)nc2c1C(=O)C(CN1CCOCC1)CC2 |
| InChI | InChI=1S/C16H24N2O2/c1-3-13-11(2)17-14-5-4-12(16(19)15(13)14)10-18-6-8-20-9-7-18/h12,17H,3-10H2,1-2H3 |
| InChIKey | KLPWJLBORRMFGK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Molindone (CHEBI:6965) has role antipsychotic agent (CHEBI:35476) |
| Molindone (CHEBI:6965) is a indoles (CHEBI:24828) |
| INN | Source |
|---|---|
| molindona | WHO MedNet |
| Synonyms | Source |
|---|---|
| moban | DrugCentral |
| (+/-)-Molindone | DrugCentral |
| Molindone | KEGG COMPOUND |
| molindone HCl | DrugCentral |
| molindone hydrochloride | DrugCentral |
| molindone monohydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1830 | DrugCentral |
| C07230 | KEGG COMPOUND |
| D08226 | KEGG DRUG |
| HMDB0015555 | HMDB |
| LSM-1709 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:7416-34-4 | KEGG COMPOUND |
| Citations |
|---|