EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27NO11 |
| Net Charge | 0 |
| Average Mass | 493.465 |
| Monoisotopic Mass | 493.15841 |
| SMILES | [H][C@@]1(O[C@@H]2OC=C(C(=O)[O-])[C@@H](/C=C/c3ccc[n+](CC(=O)O)c3)[C@H]2C=C)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C23H27NO11/c1-2-13-14(6-5-12-4-3-7-24(8-12)9-17(26)27)15(21(31)32)11-33-22(13)35-23-20(30)19(29)18(28)16(10-25)34-23/h2-8,11,13-14,16,18-20,22-23,25,28-30H,1,9-10H2,(H-,26,27,31,32)/b6-5+/t13-,14+,16-,18-,19+,20-,22+,23+/m1/s1 |
| InChIKey | BSOLHSZWRMTETL-ZHXJFFNMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lonicera japonica (ncbitaxon:105884) | flower bud (BTO:0000470) | PubMed (21942812) | Air dried flower bud. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lonijaposide K (CHEBI:69649) has role metabolite (CHEBI:25212) |
| Lonijaposide K (CHEBI:69649) is a terpene glycoside (CHEBI:61777) |
| Citations |
|---|