EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32NO10.Cl |
| Net Charge | 0 |
| Average Mass | 529.970 |
| Monoisotopic Mass | 529.17147 |
| SMILES | [Cl-].[H][C@@]1(O[C@@H]2OC=C(C(=O)OC)[C@@H](/C=C/c3ccc[n+](CCO)c3)[C@H]2C=C)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H32NO10.ClH/c1-3-15-16(7-6-14-5-4-8-25(11-14)9-10-26)17(22(31)32-2)13-33-23(15)35-24-21(30)20(29)19(28)18(12-27)34-24;/h3-8,11,13,15-16,18-21,23-24,26-30H,1,9-10,12H2,2H3;1H/q+1;/p-1/b7-6+;/t15-,16+,18-,19-,20+,21-,23+,24+;/m1./s1 |
| InChIKey | NXVSHRKSOYHAHU-GVTJHXRVSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lonicera japonica (ncbitaxon:105884) | flower bud (BTO:0000470) | PubMed (21942812) | Air dried flower bud. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lonijaposide J (CHEBI:69648) has role metabolite (CHEBI:25212) |
| Lonijaposide J (CHEBI:69648) is a organic molecular entity (CHEBI:50860) |
| Citations |
|---|