EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H33NO13 |
| Net Charge | 0 |
| Average Mass | 579.555 |
| Monoisotopic Mass | 579.19519 |
| SMILES | [H][C@@]1(O[C@@H]2OC=C(C(=O)OC)/C(=C/Cc3cc(C(=O)[O-])c[n+](CCCC(=O)O)c3)[C@H]2C=C)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H33NO13/c1-3-16-17(7-6-14-9-15(24(35)36)11-28(10-14)8-4-5-20(30)31)18(25(37)38-2)13-39-26(16)41-27-23(34)22(33)21(32)19(12-29)40-27/h3,7,9-11,13,16,19,21-23,26-27,29,32-34H,1,4-6,8,12H2,2H3,(H-,30,31,35,36)/b17-7+/t16-,19-,21-,22+,23-,26+,27+/m1/s1 |
| InChIKey | UVMYLENKGIUJAG-ICNBXRGLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lonicera japonica (ncbitaxon:105884) | flower bud (BTO:0000470) | PubMed (21942812) | Air dried flower bud. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lonijaposide H (CHEBI:69646) has role metabolite (CHEBI:25212) |
| Lonijaposide H (CHEBI:69646) is a glycoside (CHEBI:24400) |
| Citations |
|---|