EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17NOS |
| Net Charge | 0 |
| Average Mass | 187.308 |
| Monoisotopic Mass | 187.10309 |
| SMILES | CCSC(=O)N1CCCCCC1 |
| InChI | InChI=1S/C9H17NOS/c1-2-12-9(11)10-7-5-3-4-6-8-10/h2-8H2,1H3 |
| InChIKey | DEDOPGXGGQYYMW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. antispermatogenic agent An agent that destroy spermatozoa in the male genitalia and block spermatogenesis. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| molinate (CHEBI:6964) has role agrochemical (CHEBI:33286) |
| molinate (CHEBI:6964) has role antispermatogenic agent (CHEBI:145047) |
| molinate (CHEBI:6964) has role herbicide (CHEBI:24527) |
| molinate (CHEBI:6964) is a azepanes (CHEBI:46986) |
| molinate (CHEBI:6964) is a monothiocarbamic ester (CHEBI:38128) |
| IUPAC Name |
|---|
| S-ethyl azepane-1-carbothioate |
| Synonyms | Source |
|---|---|
| molinate | KEGG COMPOUND |
| S-ethyl perhydroazepine-1-thiocarboxylate | Alan Wood's Pesticides |
| S-ethyl perhydroazepine-1-carbothioate | Alan Wood's Pesticides |
| S-ethyl hexahydro-1H-azepine-1-carbothioate | Alan Wood's Pesticides |
| ethyl 1-hexamethyleneiminecarbothiolate | NIST Chemistry WebBook |
| S-ethyl N,N-hexamethylenethiocarbamate | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| Ordram | KEGG COMPOUND |
| Citations |
|---|