EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O12 |
| Net Charge | 0 |
| Average Mass | 520.487 |
| Monoisotopic Mass | 520.15808 |
| SMILES | [H][C@@]1(O[C@@H]2OC=C3C(=O)O[C@@H](/C(=C(/O)C(=O)O)c4ccccc4)C[C@@]3([H])[C@H]2C=C)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H28O12/c1-2-12-13-8-15(17(19(28)22(31)32)11-6-4-3-5-7-11)35-23(33)14(13)10-34-24(12)37-25-21(30)20(29)18(27)16(9-26)36-25/h2-7,10,12-13,15-16,18,20-21,24-30H,1,8-9H2,(H,31,32)/b19-17+/t12-,13+,15-,16-,18-,20+,21-,24+,25+/m1/s1 |
| InChIKey | JANONPLUBJJWRY-LDRWPHMTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lonicera japonica (ncbitaxon:105884) | flower bud (BTO:0000470) | PubMed (21942812) | Air dried flower bud. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Loniphenyruviridoside B, (rel)- (CHEBI:69639) has functional parent pyruvic acid (CHEBI:32816) |
| Loniphenyruviridoside B, (rel)- (CHEBI:69639) has role metabolite (CHEBI:25212) |
| Loniphenyruviridoside B, (rel)- (CHEBI:69639) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| Citations |
|---|