EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O10 |
| Net Charge | 0 |
| Average Mass | 476.478 |
| Monoisotopic Mass | 476.16825 |
| SMILES | [H][C@@]12C[C@@]([H])(OC=C1c1ccccc1)[C@@]1([H])[C@H](O[C@]3([H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)OC=C(C(=O)O)[C@@]1([H])C2 |
| InChI | InChI=1S/C24H28O10/c25-8-17-19(26)20(27)21(28)24(33-17)34-23-18-13(15(10-32-23)22(29)30)6-12-7-16(18)31-9-14(12)11-4-2-1-3-5-11/h1-5,9-10,12-13,16-21,23-28H,6-8H2,(H,29,30)/t12-,13-,16-,17-,18+,19-,20+,21-,23+,24+/m1/s1 |
| InChIKey | SCTDPJFVWAWKPB-JBKQMOEBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lonicera japonica (ncbitaxon:105884) | flower bud (BTO:0000470) | PubMed (21942812) | Air dried flower bud. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Loniphenyruviridoside A, (rel)- (CHEBI:69638) has role metabolite (CHEBI:25212) |
| Loniphenyruviridoside A, (rel)- (CHEBI:69638) is a glycoside (CHEBI:24400) |
| Citations |
|---|