EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52O2 |
| Net Charge | 0 |
| Average Mass | 444.744 |
| Monoisotopic Mass | 444.39673 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@]4(C)CC[C@H](C(C)(C)O)[C@]4([H])C[C@H](O)[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C30H52O2/c1-25(2)14-9-15-28(6)21(25)13-17-29(7)22(28)10-11-23-27(5)16-12-19(26(3,4)32)20(27)18-24(31)30(23,29)8/h19-24,31-32H,9-18H2,1-8H3/t19-,20-,21-,22+,23+,24-,27-,28-,29+,30-/m0/s1 |
| InChIKey | YARKUPNYWCQHFO-ZUXTZSAESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aschersonia (ncbitaxon:100986) | - | PubMed (21995505) | |
| Hypocrella (ncbitaxon:42305) | mycelium (BTO:0001436) | PubMed (21995505) | The fungus was isolated form scale insect Strain: BCC 14524 |
| Moelleriella (ncbitaxon:511189) | - | PubMed (21995505) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dustanin (CHEBI:69637) has role fungal metabolite (CHEBI:76946) |
| dustanin (CHEBI:69637) is a diol (CHEBI:23824) |
| dustanin (CHEBI:69637) is a hopanoid (CHEBI:51963) |
| dustanin (CHEBI:69637) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (15α)-hopane-15,22-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3085729 | Reaxys |
| Citations |
|---|