EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H54O4 |
| Net Charge | 0 |
| Average Mass | 502.780 |
| Monoisotopic Mass | 502.40221 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@]4(C)CC[C@H](C(C)(C)O)[C@]4([H])C[C@H](O)[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](OC(C)=O)CC[C@]21C |
| InChI | InChI=1S/C32H54O4/c1-19(33)36-26-14-16-30(7)22(27(26,2)3)13-17-31(8)23(30)10-11-24-29(6)15-12-20(28(4,5)35)21(29)18-25(34)32(24,31)9/h20-26,34-35H,10-18H2,1-9H3/t20-,21-,22-,23+,24+,25-,26-,29-,30-,31+,32-/m0/s1 |
| InChIKey | YVAGCSJSVHJSNX-CSTUNLOWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aschersonia (ncbitaxon:100986) | - | PubMed (21995505) | |
| Hypocrella (ncbitaxon:42305) | mycelium (BTO:0001436) | PubMed (21995505) | The fungus was isolated form scale insect Strain: BCC 14524 |
| Moelleriella (ncbitaxon:511189) | - | PubMed (21995505) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β-acetoxy-15α,22-dihydroxyhopane (CHEBI:69636) has role fungal metabolite (CHEBI:76946) |
| 3β-acetoxy-15α,22-dihydroxyhopane (CHEBI:69636) is a acetate ester (CHEBI:47622) |
| 3β-acetoxy-15α,22-dihydroxyhopane (CHEBI:69636) is a diol (CHEBI:23824) |
| 3β-acetoxy-15α,22-dihydroxyhopane (CHEBI:69636) is a hopanoid (CHEBI:51963) |
| 3β-acetoxy-15α,22-dihydroxyhopane (CHEBI:69636) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (3β,15α)-15,22-dihydroxyhopan-3-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8958855 | Reaxys |
| Citations |
|---|