EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H54O5 |
| Net Charge | 0 |
| Average Mass | 518.779 |
| Monoisotopic Mass | 518.39712 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@]4(C)CC[C@H](OC(C)=O)C(C)(C)[C@]4([H])C[C@H](O)[C@@]3(C)[C@]1(C)[C@@H](O)C[C@@]1([H])[C@@H](C(C)(C)O)CC[C@]21C |
| InChI | InChI=1S/C32H54O5/c1-18(33)37-26-13-15-30(7)22-11-10-21-29(6)14-12-19(28(4,5)36)20(29)16-24(34)31(21,8)32(22,9)25(35)17-23(30)27(26,2)3/h19-26,34-36H,10-17H2,1-9H3/t19-,20-,21+,22+,23-,24-,25-,26-,29-,30+,31-,32-/m0/s1 |
| InChIKey | NUCRCPGDAUKOEZ-KJMMORIQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypocrella (ncbitaxon:42305) | mycelium (BTO:0001436) | PubMed (21995505) | The fungus was isolated form scale insect Strain: BCC 14524 |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β-acetoxy-7β,15α,22-trihydroxyhopane (CHEBI:69633) has role fungal metabolite (CHEBI:76946) |
| 3β-acetoxy-7β,15α,22-trihydroxyhopane (CHEBI:69633) is a acetate ester (CHEBI:47622) |
| 3β-acetoxy-7β,15α,22-trihydroxyhopane (CHEBI:69633) is a hopanoid (CHEBI:51963) |
| 3β-acetoxy-7β,15α,22-trihydroxyhopane (CHEBI:69633) is a pentacyclic triterpenoid (CHEBI:25872) |
| 3β-acetoxy-7β,15α,22-trihydroxyhopane (CHEBI:69633) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (3β,7β,15α)-7,15,22-trihydroxyhopan-3-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21969325 | Reaxys |
| Citations |
|---|