EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H52O3 |
| Net Charge | 0 |
| Average Mass | 484.765 |
| Monoisotopic Mass | 484.39165 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@]4(C)CC[C@H](C(=C)C)[C@]4([H])C[C@H](O)[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](OC(C)=O)CC[C@]21C |
| InChI | InChI=1S/C32H52O3/c1-19(2)21-12-15-29(6)22(21)18-26(34)32(9)25(29)11-10-24-30(7)16-14-27(35-20(3)33)28(4,5)23(30)13-17-31(24,32)8/h21-27,34H,1,10-18H2,2-9H3/t21-,22+,23+,24-,25-,26+,27+,29+,30+,31-,32+/m1/s1 |
| InChIKey | QSVUNIKEYUWHML-GDHXYORVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypocrella (ncbitaxon:42305) | mycelium (BTO:0001436) | PubMed (21995505) | The fungus was isolated form scale insect Strain: BCC 14524 |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β-acetoxy-15α-hydroxy-22(29)-hopene (CHEBI:69631) has role fungal metabolite (CHEBI:76946) |
| 3β-acetoxy-15α-hydroxy-22(29)-hopene (CHEBI:69631) is a acetate ester (CHEBI:47622) |
| 3β-acetoxy-15α-hydroxy-22(29)-hopene (CHEBI:69631) is a hopanoid (CHEBI:51963) |
| 3β-acetoxy-15α-hydroxy-22(29)-hopene (CHEBI:69631) is a pentacyclic triterpenoid (CHEBI:25872) |
| 3β-acetoxy-15α-hydroxy-22(29)-hopene (CHEBI:69631) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3β,15α)-15-hydroxyhop-22(29)-en-3-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21969323 | Reaxys |
| Citations |
|---|