EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O2 |
| Net Charge | 0 |
| Average Mass | 442.728 |
| Monoisotopic Mass | 442.38108 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@]4(C)CCCC(C)(C)[C@]4([H])C[C@H](O)[C@@]3(C)[C@]1(C)[C@@H](O)C[C@@]1([H])[C@@H](C(=C)C)CC[C@]21C |
| InChI | InChI=1S/C30H50O2/c1-18(2)19-12-15-27(5)20(19)16-24(31)29(7)21(27)10-11-22-28(6)14-9-13-26(3,4)23(28)17-25(32)30(22,29)8/h19-25,31-32H,1,9-17H2,2-8H3/t19-,20+,21-,22-,23+,24+,25+,27+,28-,29+,30+/m1/s1 |
| InChIKey | XBRFAHRUYQHJIX-WZJQXFIWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypocrella (ncbitaxon:42305) | mycelium (BTO:0001436) | PubMed (21995505) | The fungus was isolated form scale insect Strain: BCC 14524 |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7β,15α-dihydroxy-22(29)-hopene (CHEBI:69629) has role fungal metabolite (CHEBI:76946) |
| 7β,15α-dihydroxy-22(29)-hopene (CHEBI:69629) is a diol (CHEBI:23824) |
| 7β,15α-dihydroxy-22(29)-hopene (CHEBI:69629) is a hopanoid (CHEBI:51963) |
| 7β,15α-dihydroxy-22(29)-hopene (CHEBI:69629) is a pentacyclic triterpenoid (CHEBI:25872) |
| Synonym | Source |
|---|---|
| rel-(7β,15α)-hop-22(29)-ene-7,15-diol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21969320 | Reaxys |
| Citations |
|---|