EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H48O5 |
| Net Charge | 0 |
| Average Mass | 512.731 |
| Monoisotopic Mass | 512.35017 |
| SMILES | [H][C@@]12CC=C3C(=CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@@H](CC[C@H]3O[C@@]3(C)CO)COC(C)=O)[C@@]1(C)CCC(=O)C2(C)C |
| InChI | InChI=1S/C32H48O5/c1-20(34)36-18-21(8-11-27-32(7,19-33)37-27)22-12-16-31(6)24-9-10-25-28(2,3)26(35)14-15-29(25,4)23(24)13-17-30(22,31)5/h9,13,21-22,25,27,33H,8,10-12,14-19H2,1-7H3/t21-,22+,25-,27+,29+,30+,31-,32-/m0/s1 |
| InChIKey | ZPLDNEOLUBLZNG-IMTXDYNVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypocrella (ncbitaxon:42305) | mycelium (BTO:0001436) | PubMed (21995505) | The fungus was isolated form scale insect Strain: BCC 14524 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hypocrellol G, (rel)- (CHEBI:69628) has role metabolite (CHEBI:25212) |
| Hypocrellol G, (rel)- (CHEBI:69628) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|