EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H52O6 |
| Net Charge | 0 |
| Average Mass | 556.784 |
| Monoisotopic Mass | 556.37639 |
| SMILES | [H][C@@]12CC=C3C(=CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@@H](CC[C@H]3O[C@@]3(C)CO)COC(C)=O)[C@@]1(C)CC[C@H](OC(C)=O)C2(C)C |
| InChI | InChI=1S/C34H52O6/c1-21(36)38-19-23(9-12-29-34(8,20-35)40-29)24-13-17-33(7)26-10-11-27-30(3,4)28(39-22(2)37)15-16-31(27,5)25(26)14-18-32(24,33)6/h10,14,23-24,27-29,35H,9,11-13,15-20H2,1-8H3/t23-,24+,27-,28-,29+,31+,32+,33-,34-/m0/s1 |
| InChIKey | SHYHPAQWKHVTCD-ODKKFFQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypocrella (ncbitaxon:42305) | mycelium (BTO:0001436) | PubMed (21995505) | The fungus was isolated form scale insect Strain: BCC 14524 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hypocrellol F, (rel)- (CHEBI:69627) has role metabolite (CHEBI:25212) |
| Hypocrellol F, (rel)- (CHEBI:69627) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|