EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O5 |
| Net Charge | 0 |
| Average Mass | 332.396 |
| Monoisotopic Mass | 332.16237 |
| SMILES | [H][C@]12O[C@@]1([H])C(C)=C[C@@]1([H])O[C@]3([H])C[C@@H](OC(=O)/C=C\C)[C@@](C)([C@]34CO4)[C@@]21C |
| InChI | InChI=1S/C19H24O5/c1-5-6-14(20)23-12-8-13-19(9-21-19)18(12,4)17(3)11(22-13)7-10(2)15-16(17)24-15/h5-7,11-13,15-16H,8-9H2,1-4H3/b6-5-/t11-,12-,13-,15+,16+,17-,18-,19+/m1/s1 |
| InChIKey | LAQCZBYXNRANFU-WQOXNDGTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichothecium species MSX 51320 (ncbitaxon:1094547) | - | PubMed (21978324) | Mycosynthetix fungal strain was isolated by Dr.Barry Katz from leaf litter |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mycotoxin Poisonous substance produced by fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Crotocin (CHEBI:69619) has role metabolite (CHEBI:25212) |
| Crotocin (CHEBI:69619) is a trichothecene (CHEBI:55517) |
| Synonym | Source |
|---|---|
| 4-Isocrotonyloxy-7,8-epoxyscirp-9-ene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:21284-11-7 | ChemIDplus |
| Citations |
|---|