EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H39N3O8 |
| Net Charge | 0 |
| Average Mass | 485.578 |
| Monoisotopic Mass | 485.27372 |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)C(C(C)C)OC(=O)[C@H](C)NC(=O)[C@@H]([C@@H](C)O)NC(=O)C(C(C)C)OC1=O |
| InChI | InChI=1S/C23H39N3O8/c1-9-12(6)15-23(32)34-18(11(4)5)21(30)26-16(14(8)27)19(28)24-13(7)22(31)33-17(10(2)3)20(29)25-15/h10-18,27H,9H2,1-8H3,(H,24,28)(H,25,29)(H,26,30)/t12-,13-,14+,15-,16+,17?,18?/m0/s1 |
| InChIKey | PKUOXRWYQWMYQK-VWQSNCKISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichothecium species MSX 51320 (ncbitaxon:1094547) | - | PubMed (21978324) | Mycosynthetix fungal strain was isolated by Dr.Barry Katz from leaf litter |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Roseotoxin S (CHEBI:69618) has role metabolite (CHEBI:25212) |
| Roseotoxin S (CHEBI:69618) is a cyclodepsipeptide (CHEBI:35213) |
| Citations |
|---|