EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O6 |
| Net Charge | 0 |
| Average Mass | 350.411 |
| Monoisotopic Mass | 350.17294 |
| SMILES | [H][C@]12C=C(C)[C@@H](O)[C@]3([H])OC[C@@]4(O)[C@](C)([C@H](OC(=O)/C=C\C)C[C@@]4([H])O1)[C@]23C |
| InChI | InChI=1S/C19H26O6/c1-5-6-14(20)25-12-8-13-19(22)9-23-16-15(21)10(2)7-11(24-13)17(16,3)18(12,19)4/h5-7,11-13,15-16,21-22H,8-9H2,1-4H3/b6-5-/t11-,12-,13-,15-,16+,17-,18-,19+/m1/s1 |
| InChIKey | XUBZUEDJAOOHAW-MDGBXKHPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichothecium species MSX 51320 (ncbitaxon:1094547) | - | PubMed (21978324) | Mycosynthetix fungal strain was isolated by Dr.Barry Katz from leaf litter |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trichothecene analogue (CHEBI:69616) has role metabolite (CHEBI:25212) |
| Trichothecene analogue (CHEBI:69616) is a oxacycle (CHEBI:38104) |
| Citations |
|---|