EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O7 |
| Net Charge | 0 |
| Average Mass | 406.475 |
| Monoisotopic Mass | 406.19915 |
| SMILES | [H][C@]12O[C@@]1(C(O)/C=C(C)/C=C/C=C(\C)CCC=C(C)C)C(=O)[C@H](O)O[C@H]2C(=O)OC |
| InChI | InChI=1S/C22H30O7/c1-13(2)8-6-9-14(3)10-7-11-15(4)12-16(23)22-18(24)21(26)28-17(19(22)29-22)20(25)27-5/h7-8,10-12,16-17,19,21,23,26H,6,9H2,1-5H3/b11-7+,14-10+,15-12+/t16?,17-,19-,21-,22+/m1/s1 |
| InChIKey | IREYQNQKCFYKND-ISSAMECVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichothecium species MSX 51320 (ncbitaxon:1094547) | - | PubMed (21978324) | Mycosynthetix fungal strain was isolated by Dr.Barry Katz from leaf litter |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trichothosporon A, (rel)- (CHEBI:69615) has role metabolite (CHEBI:25212) |
| Trichothosporon A, (rel)- (CHEBI:69615) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| rel-alpha-L-lyxo-Hex-2-ulosepyranuronic acid, 3,4-anhydro-3-C-[(2E,4E,6E)-1-hydroxy-3,7,11-trimethyl-2,4,6,10-dodecatetraen-1-yl]-, methyl ester | ChEBI |
| Citations |
|---|