EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H54N4O9 |
| Net Charge | 0 |
| Average Mass | 674.836 |
| Monoisotopic Mass | 674.38908 |
| SMILES | CC(C)C[C@@H]1OC(=O)[C@H](C(C)C)OC(=O)[C@H](CO)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C35H54N4O9/c1-19(2)15-26-30(41)38-28(21(5)6)32(43)37-25(18-40)34(45)48-29(22(7)8)35(46)47-27(16-20(3)4)31(42)36-24(33(44)39(26)9)17-23-13-11-10-12-14-23/h10-14,19-22,24-29,40H,15-18H2,1-9H3,(H,36,42)(H,37,43)(H,38,41)/t24-,25-,26-,27-,28-,29-/m0/s1 |
| InChIKey | OFQBSWDOEHTKQI-AQRCPPRCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichothecium species MSX 51320 (ncbitaxon:1094547) | - | PubMed (21978324) | Mycosynthetix fungal strain was isolated by Dr.Barry Katz from leaf litter |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trichodepsipeptide B (CHEBI:69614) has role metabolite (CHEBI:25212) |
| Trichodepsipeptide B (CHEBI:69614) is a cyclodepsipeptide (CHEBI:35213) |
| Citations |
|---|