EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H56N4O9 |
| Net Charge | 0 |
| Average Mass | 688.863 |
| Monoisotopic Mass | 688.40473 |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(C)C)OC(=O)[C@H](C(C)C)OC(=O)[C@H](CO)NC1=O |
| InChI | InChI=1S/C36H56N4O9/c1-20(2)15-25-31(42)39-27(19-41)35(46)49-30(23(7)8)36(47)48-29(17-22(5)6)33(44)38-26(18-24-13-11-10-12-14-24)34(45)40(9)28(16-21(3)4)32(43)37-25/h10-14,20-23,25-30,41H,15-19H2,1-9H3,(H,37,43)(H,38,44)(H,39,42)/t25-,26-,27-,28-,29-,30-/m0/s1 |
| InChIKey | ITNSWMYMZKJXQE-WPMUBMLPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichothecium species MSX 51320 (ncbitaxon:1094547) | - | PubMed (21978324) | Mycosynthetix fungal strain was isolated by Dr.Barry Katz from leaf litter |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trichodepsipeptide A (CHEBI:69613) has role metabolite (CHEBI:25212) |
| Trichodepsipeptide A (CHEBI:69613) is a cyclodepsipeptide (CHEBI:35213) |
| Citations |
|---|