EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34N2O7.HCl |
| Net Charge | 0 |
| Average Mass | 535.037 |
| Monoisotopic Mass | 534.21328 |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N1Cc2cc(OC)c(OC)cc2C[C@H]1C(=O)O.Cl |
| InChI | InChI=1S/C27H34N2O7.ClH/c1-5-36-27(33)21(12-11-18-9-7-6-8-10-18)28-17(2)25(30)29-16-20-15-24(35-4)23(34-3)14-19(20)13-22(29)26(31)32;/h6-10,14-15,17,21-22,28H,5,11-13,16H2,1-4H3,(H,31,32);1H/t17-,21-,22-;/m0./s1 |
| InChIKey | JXRAXHBVZQZSIC-JKVLGAQCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Moexipril hydrochloride (CHEBI:6961) has role antihypertensive agent (CHEBI:35674) |
| Moexipril hydrochloride (CHEBI:6961) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| CI 925 | ChEMBL |
| CI-925 | ChEMBL |
| Moexipril hydrochloride | KEGG COMPOUND |
| RS-10085-197 | ChEMBL |
| SPM 925 | ChEMBL |
| SPM-925 | ChEMBL |
| Brand Names | Source |
|---|---|
| Moexipril hydrochloride component of uniretic | ChEMBL |
| Perdix | ChEMBL |
| Univasc | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00623 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:82586-52-5 | KEGG COMPOUND |