EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H78O17 |
| Net Charge | 0 |
| Average Mass | 915.124 |
| Monoisotopic Mass | 914.52390 |
| SMILES | [H][C@@]1(O[C@H]2CO[C@@]([H])(O[C@H]3CC[C@]4(C)[C@@]5([H])CC=C6[C@]7([H])CC(C)(C)CC[C@]7(CO)[C@H](O)C[C@@]6(C)[C@]5(C)CC[C@@]4([H])C3(C)C)[C@H](O[C@]3([H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C47H78O17/c1-42(2)14-15-47(21-50)23(16-42)22-8-9-28-44(5)12-11-30(43(3,4)27(44)10-13-45(28,6)46(22,7)17-29(47)51)63-41-38(64-40-37(58)35(56)32(53)25(19-49)61-40)33(54)26(20-59-41)62-39-36(57)34(55)31(52)24(18-48)60-39/h8,23-41,48-58H,9-21H2,1-7H3/t23-,24+,25+,26-,27-,28+,29+,30-,31+,32+,33-,34-,35-,36+,37+,38+,39-,40-,41-,44-,45+,46+,47+/m0/s1 |
| InChIKey | KDMNJNSCPQVDIN-JYBDQZIRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lysimachia clethroides (ncbitaxon:167892) | aerial part (BTO:0001658) | PubMed (21928797) | Air-dried, powdered aerial parts were extracted with 70% aqueous ethyl alcohol. |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clethroidoside A (CHEBI:69601) has functional parent primulagenin A (CHEBI:70978) |
| clethroidoside A (CHEBI:69601) has parent hydride oleanane (CHEBI:36481) |
| clethroidoside A (CHEBI:69601) has role plant metabolite (CHEBI:76924) |
| clethroidoside A (CHEBI:69601) is a diol (CHEBI:23824) |
| clethroidoside A (CHEBI:69601) is a pentacyclic triterpenoid (CHEBI:25872) |
| clethroidoside A (CHEBI:69601) is a trisaccharide derivative (CHEBI:63571) |
| clethroidoside A (CHEBI:69601) is a triterpenoid saponin (CHEBI:61778) |
| IUPAC Name |
|---|
| (3β,16α)-16,28-dihydroxyolean-12-en-3-yl β-D-glucopyranosyl-(1→2)-[β-D-glucopyranosyl-(1→4)]-α-L-arabinopyranoside |
| Synonym | Source |
|---|---|
| 3-O-β-D-glucopyranosyl-(1→2)-[β-D-glucopyranosyl-(1→4)]-α-L-arabinopyranosyl-3β,16α,28-trihydroxyolean-12-ene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22007800 | Reaxys |
| Citations |
|---|