EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34N2O7 |
| Net Charge | 0 |
| Average Mass | 498.576 |
| Monoisotopic Mass | 498.23660 |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N1Cc2cc(OC)c(OC)cc2C[C@H]1C(=O)O |
| InChI | InChI=1S/C27H34N2O7/c1-5-36-27(33)21(12-11-18-9-7-6-8-10-18)28-17(2)25(30)29-16-20-15-24(35-4)23(34-3)14-19(20)13-22(29)26(31)32/h6-10,14-15,17,21-22,28H,5,11-13,16H2,1-4H3,(H,31,32)/t17-,21-,22-/m0/s1 |
| InChIKey | UWWDHYUMIORJTA-HSQYWUDLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Moexipril (CHEBI:6960) has role cardiovascular drug (CHEBI:35554) |
| Moexipril (CHEBI:6960) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| moclobenid | DrugCentral |
| Moexipril | KEGG COMPOUND |
| moexipril HCl | DrugCentral |
| moexipril hydrochloride | DrugCentral |
| RS-10085 | ChEMBL |
| Uniretic | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1827 | DrugCentral |
| C07704 | KEGG COMPOUND |
| D08225 | KEGG DRUG |
| HMDB0014829 | HMDB |
| LSM-2751 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:103775-10-6 | KEGG COMPOUND |
| Citations |
|---|