EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H33N3O2 |
| Net Charge | 0 |
| Average Mass | 383.536 |
| Monoisotopic Mass | 383.25728 |
| SMILES | [H][C@]1([C@@H](C)CC)C(=O)N[C@H](CO)Cc2cnc3c(C(C)(C)C=C)ccc(c23)N1C |
| InChI | InChI=1S/C23H33N3O2/c1-7-14(3)21-22(28)25-16(13-27)11-15-12-24-20-17(23(4,5)8-2)9-10-18(19(15)20)26(21)6/h8-10,12,14,16,21,24,27H,2,7,11,13H2,1,3-6H3,(H,25,28)/t14-,16-,21-/m0/s1 |
| InChIKey | DALRIICDQKRRFF-HTZUNMPGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marinactinospora thermotolerans (ncbitaxon:531310) | |||
| spore (BTO:0001171) | PubMed (21977916) | Crude extract of fermented medium inoculated with spores and mycelia Strain: SCSIO 00652 | |
| mycelium (BTO:0001436) | PubMed (21977916) | Crude extract of fermented medium inoculated with spores and mycelia Strain: SCSIO 00652 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methylpendolmycin (CHEBI:69599) has role metabolite (CHEBI:25212) |
| Methylpendolmycin (CHEBI:69599) is a indoles (CHEBI:24828) |
| Synonym | Source |
|---|---|
| (2S,5S)-2-[(2S)-2-Butanyl]-5-(hydroxymethyl)-1-methyl-9-(2-methyl-3-buten-2-yl)-1,2,4,5,6,8-hexahydro-3H-[1,4]diazonino[7,6,5-cd]indol-3-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 0138590600 | ChemIDplus |
| Citations |
|---|