EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H19N3O2 |
| Net Charge | 0 |
| Average Mass | 357.413 |
| Monoisotopic Mass | 357.14773 |
| SMILES | CC(=O)c1nc(C(=O)NCCc2ccccc2)cc2c1nc1ccccc12 |
| InChI | InChI=1S/C22H19N3O2/c1-14(26)20-21-17(16-9-5-6-10-18(16)24-21)13-19(25-20)22(27)23-12-11-15-7-3-2-4-8-15/h2-10,13,24H,11-12H2,1H3,(H,23,27) |
| InChIKey | QPUYCBSQXKSFOO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marinactinospora thermotolerans (ncbitaxon:531310) | |||
| mycelium (BTO:0001436) | PubMed (21977916) | Crude extract of fermented medium inoculated with spores and mycelia Strain: SCSIO 00652 | |
| spore (BTO:0001171) | PubMed (21977916) | Crude extract of fermented medium inoculated with spores and mycelia Strain: SCSIO 00652 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Marinacarboline C (CHEBI:69594) has role metabolite (CHEBI:25212) |
| Marinacarboline C (CHEBI:69594) is a harmala alkaloid (CHEBI:61379) |
| Synonyms | Source |
|---|---|
| 4'deshydroxy-marinacarboline B | ChEBI |
| 1-Acetyl-N-(2-phenylethyl)-9H-beta-carboline-3-carboxamide | ChEBI |
| Citations |
|---|