EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H19N3O3 |
| Net Charge | 0 |
| Average Mass | 373.412 |
| Monoisotopic Mass | 373.14264 |
| SMILES | CC(=O)c1nc(C(=O)NCCc2ccc(O)cc2)cc2c1nc1ccccc12 |
| InChI | InChI=1S/C22H19N3O3/c1-13(26)20-21-17(16-4-2-3-5-18(16)24-21)12-19(25-20)22(28)23-11-10-14-6-8-15(27)9-7-14/h2-9,12,24,27H,10-11H2,1H3,(H,23,28) |
| InChIKey | XHHABJFVNYNXCX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marinactinospora thermotolerans (ncbitaxon:531310) | |||
| mycelium (BTO:0001436) | PubMed (21977916) | Crude extract of fermented medium inoculated with spores and mycelia Strain: SCSIO 00652 | |
| spore (BTO:0001171) | PubMed (21977916) | Crude extract of fermented medium inoculated with spores and mycelia Strain: SCSIO 00652 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| marinacarboline B (CHEBI:69593) is a methyl ketone (CHEBI:51867) |
| marinacarboline B (CHEBI:69593) is a monocarboxylic acid amide (CHEBI:29347) |
| marinacarboline B (CHEBI:69593) is a phenols (CHEBI:33853) |
| marinacarboline B (CHEBI:69593) is a β-carboline alkaloid (CHEBI:83325) |
| IUPAC Name |
|---|
| 1-acetyl-N-[2-(4-hydroxyphenyl)ethyl]-9H-β-carboline-3-carboxamide |
| Synonym | Source |
|---|---|
| 4'O - desmethyl marinacarboline A | ChEBI |
| Citations |
|---|