EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O6 |
| Net Charge | 0 |
| Average Mass | 360.406 |
| Monoisotopic Mass | 360.15729 |
| SMILES | COc1cc2c(cc1O)[C@H](CO)[C@@H](c1ccc(CCCO)c(OC)c1)O2 |
| InChI | InChI=1S/C20H24O6/c1-24-17-8-13(6-5-12(17)4-3-7-21)20-15(11-22)14-9-16(23)19(25-2)10-18(14)26-20/h5-6,8-10,15,20-23H,3-4,7,11H2,1-2H3/t15-,20+/m0/s1 |
| InChIKey | DTWUHAOZSGPUHQ-MGPUTAFESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paeonia rockii subsp. rockii (ncbitaxon:459179) | root (BTO:0001188) | PubMed (21954959) | Isolated from chloroform soluble extract of air-dried and powdered roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lawsonicin (CHEBI:69591) has role metabolite (CHEBI:25212) |
| Lawsonicin (CHEBI:69591) is a benzofurans (CHEBI:35259) |
| Citations |
|---|