EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H44O4 |
| Net Charge | 0 |
| Average Mass | 456.667 |
| Monoisotopic Mass | 456.32396 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(=C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)CC[C@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C29H44O4/c1-18-8-13-29(24(32)33)15-14-27(4)19(20(29)16-18)6-7-22-25(2)11-10-23(31)26(3,17-30)21(25)9-12-28(22,27)5/h6,20-23,30-31H,1,7-17H2,2-5H3,(H,32,33)/t20-,21+,22+,23-,25-,26-,27+,28+,29-/m0/s1 |
| InChIKey | FKUBIEWSGBVADJ-VZBPFLCRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paeonia rockii subsp. rockii (ncbitaxon:459179) | root (BTO:0001188) | PubMed (21954959) | Isolated from chloroform soluble extract of air-dried and powdered roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 30-nor-Hederagenin (CHEBI:69589) has role metabolite (CHEBI:25212) |
| 30-nor-Hederagenin (CHEBI:69589) is a steroid (CHEBI:35341) |
| Citations |
|---|