EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H46O5 |
| Net Charge | 0 |
| Average Mass | 474.682 |
| Monoisotopic Mass | 474.33452 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)CC[C@H](O)[C@@]1(O)CO |
| InChI | InChI=1S/C29H46O5/c1-24(2)12-14-28(23(32)33)15-13-26(4)18(19(28)16-24)6-7-20-25(3)10-9-22(31)29(34,17-30)21(25)8-11-27(20,26)5/h6,19-22,30-31,34H,7-17H2,1-5H3,(H,32,33)/t19-,20+,21+,22-,25+,26+,27+,28-,29+/m0/s1 |
| InChIKey | NOYVDDIWMWHGKL-FENDIVEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paeonia rockii subsp. rockii (ncbitaxon:459179) | root (BTO:0001188) | PubMed (21954959) | Isolated from chloroform soluble extract of air-dried and powdered roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3beta,4beta,23-trihydroxy-24-nor-olean-12-en-28-oic acid (CHEBI:69578) has role metabolite (CHEBI:25212) |
| 3beta,4beta,23-trihydroxy-24-nor-olean-12-en-28-oic acid (CHEBI:69578) is a hydroxy steroid (CHEBI:35350) |
| Citations |
|---|