EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H34O6 |
| Net Charge | 0 |
| Average Mass | 550.651 |
| Monoisotopic Mass | 550.23554 |
| SMILES | COc1cc(O)c([C@H](/C=C/C[C@H](O)CCc2ccccc2)c2ccc(O)cc2)c(O)c1C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C35H34O6/c1-41-32-23-31(39)33(35(40)34(32)30(38)22-16-25-11-6-3-7-12-25)29(26-17-20-28(37)21-18-26)14-8-13-27(36)19-15-24-9-4-2-5-10-24/h2-12,14,16-18,20-23,27,29,36-37,39-40H,13,15,19H2,1H3/b14-8+,22-16+/t27-,29+/m0/s1 |
| InChIKey | DJTINKKXBIBDGX-ATHMESRBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alpinia katsumadai (IPNI:871977-1) | seed (BTO:0001226) | PubMed (21942765) | Methanolic extract of seeds |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-Alpinnanin B (CHEBI:69570) has role metabolite (CHEBI:25212) |
| ent-Alpinnanin B (CHEBI:69570) is a diarylheptanoid (CHEBI:78802) |
| Synonym | Source |
|---|---|
| (2E)-1-{2,4-dihydroxy-3-[(1R,2E,5R)-5-hydroxy-1-(4-hydroxyphenyl)-7-phenyl-2-hepten-1-yl]-6-methoxyphenyl}-3-phenyl-2-propen-1-one | ChEBI |
| Citations |
|---|