EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O3 |
| Net Charge | 0 |
| Average Mass | 296.366 |
| Monoisotopic Mass | 296.14124 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)C[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C19H20O3/c20-17-10-6-16(7-11-17)9-13-19(22)14-18(21)12-8-15-4-2-1-3-5-15/h1-7,9-11,13,18,20-21H,8,12,14H2/b13-9+/t18-/m1/s1 |
| InChIKey | MMBRTMDGWOPBHK-FHLIRTJZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alpinia katsumadai (IPNI:871977-1) | seed (BTO:0001226) | PubMed (21942765) | Methanolic extract of seeds |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-(R)-4''-Hydroxyyashabushiketol (CHEBI:69566) has role metabolite (CHEBI:25212) |
| (-)-(R)-4''-Hydroxyyashabushiketol (CHEBI:69566) is a diarylheptanoid (CHEBI:78802) |
| Synonym | Source |
|---|---|
| (3R)-3-hydroxy-1-phenyl-7-(4-hydroxyphenyl)-6E-hepten-5-one | ChEBI |
| Citations |
|---|