EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O4 |
| Net Charge | 0 |
| Average Mass | 296.322 |
| Monoisotopic Mass | 296.10486 |
| SMILES | OCCCc1ccc2oc(-c3ccc4c(c3)OCO4)cc2c1 |
| InChI | InChI=1S/C18H16O4/c19-7-1-2-12-3-5-15-14(8-12)10-17(22-15)13-4-6-16-18(9-13)21-11-20-16/h3-6,8-10,19H,1-2,7,11H2 |
| InChIKey | YQEPMZLWYOAQNI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Styrax agrestis (ncbitaxon:153522) | ripe fruit (PO:0007038) | PubMed (21939219) | Dried, powdered fruits were extracted with ethylacetate. |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-demethoxyegonol (CHEBI:69557) has functional parent egonol (CHEBI:69558) |
| 7-demethoxyegonol (CHEBI:69557) has parent hydride 1-benzofuran (CHEBI:35260) |
| 7-demethoxyegonol (CHEBI:69557) has role metabolite (CHEBI:25212) |
| 7-demethoxyegonol (CHEBI:69557) has role plant metabolite (CHEBI:76924) |
| 7-demethoxyegonol (CHEBI:69557) is a 1-benzofurans (CHEBI:38830) |
| 7-demethoxyegonol (CHEBI:69557) is a benzodioxoles (CHEBI:38298) |
| 7-demethoxyegonol (CHEBI:69557) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| 3-[2-(1,3-benzodioxol-5-yl)-1-benzofuran-5-yl]propan-1-ol |
| Synonyms | Source |
|---|---|
| 5-(3-hydroxypropyl)-2-(3,4-methylenedioxyphenyl)benzofuran | ChEBI |
| demethoxyegonol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1390615 | Reaxys |
| Citations |
|---|