EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O6 |
| Net Charge | 0 |
| Average Mass | 396.439 |
| Monoisotopic Mass | 396.15729 |
| SMILES | CCCC(=O)OCCCc1cc(OC)c2oc(-c3ccc4c(c3)OCO4)cc2c1 |
| InChI | InChI=1S/C23H24O6/c1-3-5-22(24)26-9-4-6-15-10-17-13-19(29-23(17)21(11-15)25-2)16-7-8-18-20(12-16)28-14-27-18/h7-8,10-13H,3-6,9,14H2,1-2H3 |
| InChIKey | ZIUFRHWVDXFFEI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Styrax agrestis (ncbitaxon:153522) | ripe fruit (PO:0007038) | PubMed (21939219) | Dried, powdered fruits were extracted with ethylacetate. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| egonolbutanoate (CHEBI:69555) has functional parent egonol (CHEBI:69558) |
| egonolbutanoate (CHEBI:69555) has parent hydride 1-benzofuran (CHEBI:35260) |
| egonolbutanoate (CHEBI:69555) has role plant metabolite (CHEBI:76924) |
| egonolbutanoate (CHEBI:69555) is a 1-benzofurans (CHEBI:38830) |
| egonolbutanoate (CHEBI:69555) is a aromatic ether (CHEBI:35618) |
| egonolbutanoate (CHEBI:69555) is a benzodioxoles (CHEBI:38298) |
| egonolbutanoate (CHEBI:69555) is a butyrate ester (CHEBI:50477) |
| egonolbutanoate (CHEBI:69555) is a fatty acid ester (CHEBI:35748) |
| IUPAC Name |
|---|
| 3-[2-(1,3-benzodioxol-5-yl)-7-methoxy-1-benzofuran-5-yl]propyl butanoate |
| Synonym | Source |
|---|---|
| 5-(3-butanoyloxypropyl)-7-methoxy-2-(3,4-methylenedioxyphenyl)benzofuran | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10384634 | Reaxys |
| Citations |
|---|